C12H14N2O2S — CID 168668879
S-[(5-oxo-1-pyridin-3-ylpyrrolidin-3-yl)methyl] ethanethioate (PubChem CID 168668879) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is S-[(5-oxo-1-pyridin-3-ylpyrrolidin-3-yl)methyl] ethanethioate.
| Compound Name | S-[(5-oxo-1-pyridin-3-ylpyrrolidin-3-yl)methyl] ethanethioate |
|---|---|
| PubChem CID | 168668879 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | S-[(5-oxo-1-pyridin-3-ylpyrrolidin-3-yl)methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2cccnc2)C1 |
| InChI | InChI=1S/C12H14N2O2S/c1-9(15)17-8-10-5-12(16)14(7-10)11-3-2-4-13-6-11/h2-4,6,10H,5,7-8H2,1H3 |
| InChIKey | ZFJQRFNDXNSKDE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|