C14H16N2O4S — CID 168666755
methyl 5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate (PubChem CID 168666755) has the molecular formula C14H16N2O4S and a molecular weight of 308.36 g/mol. Its IUPAC name is methyl 5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate.
| Compound Name | methyl 5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 168666755 |
| Molecular Formula | C14H16N2O4S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | methyl 5-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cncc(N2CC(CSC(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C14H16N2O4S/c1-9(17)21-8-10-3-13(18)16(7-10)12-4-11(5-15-6-12)14(19)20-2/h4-6,10H,3,7-8H2,1-2H3 |
| InChIKey | ZEGXZEFBKGEZLT-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|