C12H14N2O4S2 — CID 168666732
methyl 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazole-5-carboxylate (PubChem CID 168666732) has the molecular formula C12H14N2O4S2 and a molecular weight of 314.39 g/mol. Its IUPAC name is methyl 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 168666732 |
| Molecular Formula | C12H14N2O4S2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.04 |
| IUPAC Name | methyl 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1scnc1N1CC(CSC(C)=O)CC1=O |
| InChI | InChI=1S/C12H14N2O4S2/c1-7(15)19-5-8-3-9(16)14(4-8)11-10(12(17)18-2)20-6-13-11/h6,8H,3-5H2,1-2H3 |
| InChIKey | YBSZDNMVIQXHHB-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|