C9H10N2O3S2 — CID 168708465
methyl 4-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1,3-thiazole-5-carboxylate (PubChem CID 168708465) has the molecular formula C9H10N2O3S2 and a molecular weight of 258.32 g/mol. Its IUPAC name is methyl 4-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 168708465 |
| Molecular Formula | C9H10N2O3S2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.01 |
| IUPAC Name | methyl 4-(2-oxo-4-sulfanylpyrrolidin-1-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1scnc1N1CC(S)CC1=O |
| InChI | InChI=1S/C9H10N2O3S2/c1-14-9(13)7-8(10-4-16-7)11-3-5(15)2-6(11)12/h4-5,15H,2-3H2,1H3 |
| InChIKey | UINIRTBYPLMFQA-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|