C11H11BrN2O3S — CID 168708408
methyl 5-bromo-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyridine-2-carboxylate (PubChem CID 168708408) has the molecular formula C11H11BrN2O3S and a molecular weight of 331.19 g/mol. Its IUPAC name is methyl 5-bromo-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyridine-2-carboxylate.
| Compound Name | methyl 5-bromo-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 168708408 |
| Molecular Formula | C11H11BrN2O3S |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 329.97 |
| IUPAC Name | methyl 5-bromo-3-(2-oxo-4-sulfanylpyrrolidin-1-yl)pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(Br)cc1N1CC(S)CC1=O |
| InChI | InChI=1S/C11H11BrN2O3S/c1-17-11(16)10-8(2-6(12)4-13-10)14-5-7(18)3-9(14)15/h2,4,7,18H,3,5H2,1H3 |
| InChIKey | YQXHTUNQGIUDNV-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|