C12H13BrN2O3S — CID 168670004
methyl 5-bromo-3-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-2-carboxylate (PubChem CID 168670004) has the molecular formula C12H13BrN2O3S and a molecular weight of 345.22 g/mol. Its IUPAC name is methyl 5-bromo-3-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-2-carboxylate.
| Compound Name | methyl 5-bromo-3-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 168670004 |
| Molecular Formula | C12H13BrN2O3S |
| Molecular Weight | 345.22 g/mol |
| Exact Mass | 343.98 |
| IUPAC Name | methyl 5-bromo-3-[2-oxo-4-(sulfanylmethyl)pyrrolidin-1-yl]pyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(Br)cc1N1CC(CS)CC1=O |
| InChI | InChI=1S/C12H13BrN2O3S/c1-18-12(17)11-9(3-8(13)4-14-11)15-5-7(6-19)2-10(15)16/h3-4,7,19H,2,5-6H2,1H3 |
| InChIKey | NJCXXLULXLZFFJ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 59.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.22 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|