C14H15BrN2O4S — CID 168666675
methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-bromopyridine-2-carboxylate (PubChem CID 168666675) has the molecular formula C14H15BrN2O4S and a molecular weight of 387.26 g/mol. Its IUPAC name is methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-bromopyridine-2-carboxylate.
| Compound Name | methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-bromopyridine-2-carboxylate |
|---|---|
| PubChem CID | 168666675 |
| Molecular Formula | C14H15BrN2O4S |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 385.99 |
| IUPAC Name | methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-5-bromopyridine-2-carboxylate |
| SMILES | COC(=O)c1ncc(Br)cc1N1CC(CSC(C)=O)CC1=O |
| InChI | InChI=1S/C14H15BrN2O4S/c1-8(18)22-7-9-3-12(19)17(6-9)11-4-10(15)5-16-13(11)14(20)21-2/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | CUKRJHQIHDMLMW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|