C15H16BrNO4S — CID 168666692
methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4-bromobenzoate (PubChem CID 168666692) has the molecular formula C15H16BrNO4S and a molecular weight of 386.27 g/mol. Its IUPAC name is methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4-bromobenzoate.
| Compound Name | methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4-bromobenzoate |
|---|---|
| PubChem CID | 168666692 |
| Molecular Formula | C15H16BrNO4S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | methyl 3-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4-bromobenzoate |
| SMILES | COC(=O)c1ccc(Br)c(N2CC(CSC(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C15H16BrNO4S/c1-9(18)22-8-10-5-14(19)17(7-10)13-6-11(15(20)21-2)3-4-12(13)16/h3-4,6,10H,5,7-8H2,1-2H3 |
| InChIKey | KGEJOVITAMXUOL-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|