C14H14BrNO4S — CID 168668349
4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-bromobenzoic acid (PubChem CID 168668349) has the molecular formula C14H14BrNO4S and a molecular weight of 372.24 g/mol. Its IUPAC name is 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-bromobenzoic acid.
| Compound Name | 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-bromobenzoic acid |
|---|---|
| PubChem CID | 168668349 |
| Molecular Formula | C14H14BrNO4S |
| Molecular Weight | 372.24 g/mol |
| Exact Mass | 370.98 |
| IUPAC Name | 4-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-3-bromobenzoic acid |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc(C(=O)O)cc2Br)C1 |
| InChI | InChI=1S/C14H14BrNO4S/c1-8(17)21-7-9-4-13(18)16(6-9)12-3-2-10(14(19)20)5-11(12)15/h2-3,5,9H,4,6-7H2,1H3,(H,19,20) |
| InChIKey | KPSIQADXBOEGIW-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.24 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|