C13H13Cl2NO2S — CID 168668360
S-[[1-(2,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668360) has the molecular formula C13H13Cl2NO2S and a molecular weight of 318.23 g/mol. Its IUPAC name is S-[[1-(2,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(2,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668360 |
| Molecular Formula | C13H13Cl2NO2S |
| Molecular Weight | 318.23 g/mol |
| Exact Mass | 317.00 |
| IUPAC Name | S-[[1-(2,4-dichlorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc(Cl)cc2Cl)C1 |
| InChI | InChI=1S/C13H13Cl2NO2S/c1-8(17)19-7-9-4-13(18)16(6-9)12-3-2-10(14)5-11(12)15/h2-3,5,9H,4,6-7H2,1H3 |
| InChIKey | LMYBBZNZGYREOS-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.23 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|