C13H12BrF2NO2S — CID 168668062
S-[[1-(2-bromo-4,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668062) has the molecular formula C13H12BrF2NO2S and a molecular weight of 364.21 g/mol. Its IUPAC name is S-[[1-(2-bromo-4,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(2-bromo-4,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668062 |
| Molecular Formula | C13H12BrF2NO2S |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 362.97 |
| IUPAC Name | S-[[1-(2-bromo-4,5-difluorophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2cc(F)c(F)cc2Br)C1 |
| InChI | InChI=1S/C13H12BrF2NO2S/c1-7(18)20-6-8-2-13(19)17(5-8)12-4-11(16)10(15)3-9(12)14/h3-4,8H,2,5-6H2,1H3 |
| InChIKey | ZLMNZLPAYAJEFQ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|