C14H15F2NO3S — CID 168666848
S-[[1-(2,6-difluoro-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666848) has the molecular formula C14H15F2NO3S and a molecular weight of 315.34 g/mol. Its IUPAC name is S-[[1-(2,6-difluoro-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(2,6-difluoro-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666848 |
| Molecular Formula | C14H15F2NO3S |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | S-[[1-(2,6-difluoro-4-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | COc1cc(F)c(N2CC(CSC(C)=O)CC2=O)c(F)c1 |
| InChI | InChI=1S/C14H15F2NO3S/c1-8(18)21-7-9-3-13(19)17(6-9)14-11(15)4-10(20-2)5-12(14)16/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | AVQSFGFALLXOKT-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|