C15H16N2O3S — CID 168666825
S-[[1-(2-cyano-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666825) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is S-[[1-(2-cyano-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(2-cyano-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666825 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | S-[[1-(2-cyano-5-methoxyphenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | COc1ccc(C#N)c(N2CC(CSC(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C15H16N2O3S/c1-10(18)21-9-11-5-15(19)17(8-11)14-6-13(20-2)4-3-12(14)7-16/h3-4,6,11H,5,8-9H2,1-2H3 |
| InChIKey | WBGGGZMNYPXMCY-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|