C16H19NO6S — CID 168666921
2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4,6-dimethoxybenzoic acid (PubChem CID 168666921) has the molecular formula C16H19NO6S and a molecular weight of 353.40 g/mol. Its IUPAC name is 2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4,6-dimethoxybenzoic acid.
| Compound Name | 2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4,6-dimethoxybenzoic acid |
|---|---|
| PubChem CID | 168666921 |
| Molecular Formula | C16H19NO6S |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 2-[4-(acetylsulfanylmethyl)-2-oxopyrrolidin-1-yl]-4,6-dimethoxybenzoic acid |
| SMILES | COc1cc(OC)c(C(=O)O)c(N2CC(CSC(C)=O)CC2=O)c1 |
| InChI | InChI=1S/C16H19NO6S/c1-9(18)24-8-10-4-14(19)17(7-10)12-5-11(22-2)6-13(23-3)15(12)16(20)21/h5-6,10H,4,7-8H2,1-3H3,(H,20,21) |
| InChIKey | NBAYLDYRXMEBLT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|