C14H15BrN2O5S — CID 168666801
S-[[1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168666801) has the molecular formula C14H15BrN2O5S and a molecular weight of 403.25 g/mol. Its IUPAC name is S-[[1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168666801 |
| Molecular Formula | C14H15BrN2O5S |
| Molecular Weight | 403.25 g/mol |
| Exact Mass | 401.99 |
| IUPAC Name | S-[[1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | COc1cc(N2CC(CSC(C)=O)CC2=O)c([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C14H15BrN2O5S/c1-8(18)23-7-9-3-14(19)16(6-9)11-5-13(22-2)10(15)4-12(11)17(20)21/h4-5,9H,3,6-7H2,1-2H3 |
| InChIKey | TYSIVUXLSFDWCY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|