C13H12BrClN2O4S — CID 168668029
S-[[1-(4-bromo-2-chloro-6-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668029) has the molecular formula C13H12BrClN2O4S and a molecular weight of 407.67 g/mol. Its IUPAC name is S-[[1-(4-bromo-2-chloro-6-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-(4-bromo-2-chloro-6-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668029 |
| Molecular Formula | C13H12BrClN2O4S |
| Molecular Weight | 407.67 g/mol |
| Exact Mass | 405.94 |
| IUPAC Name | S-[[1-(4-bromo-2-chloro-6-nitrophenyl)-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2c(Cl)cc(Br)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C13H12BrClN2O4S/c1-7(18)22-6-8-2-12(19)16(5-8)13-10(15)3-9(14)4-11(13)17(20)21/h3-4,8H,2,5-6H2,1H3 |
| InChIKey | DIRBZCBIEAZARH-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 80.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.67 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|