C11H12BrN3O6S — CID 168717371
1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717371) has the molecular formula C11H12BrN3O6S and a molecular weight of 394.20 g/mol. Its IUPAC name is 1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717371 |
| Molecular Formula | C11H12BrN3O6S |
| Molecular Weight | 394.20 g/mol |
| Exact Mass | 392.96 |
| IUPAC Name | 1-(4-bromo-5-methoxy-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | COc1cc(N2CC(S(N)(=O)=O)CC2=O)c([N+](=O)[O-])cc1Br |
| InChI | InChI=1S/C11H12BrN3O6S/c1-21-10-4-8(9(15(17)18)3-7(10)12)14-5-6(2-11(14)16)22(13,19)20/h3-4,6H,2,5H2,1H3,(H2,13,19,20) |
| InChIKey | IHXRNXZPKLWPQW-UHFFFAOYSA-N |
| XLogP | 0.76 |
| TPSA | 132.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.20 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|