C12H15ClN2O5S — CID 168717358
1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717358) has the molecular formula C12H15ClN2O5S and a molecular weight of 334.78 g/mol. Its IUPAC name is 1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717358 |
| Molecular Formula | C12H15ClN2O5S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.04 |
| IUPAC Name | 1-(5-chloro-2,4-dimethoxyphenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | COc1cc(OC)c(N2CC(S(N)(=O)=O)CC2=O)cc1Cl |
| InChI | InChI=1S/C12H15ClN2O5S/c1-19-10-5-11(20-2)9(4-8(10)13)15-6-7(3-12(15)16)21(14,17)18/h4-5,7H,3,6H2,1-2H3,(H2,14,17,18) |
| InChIKey | AXWBRAMZHBZYER-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |