C13H18N2O5S — CID 168717594
1-(4,5-dimethoxy-2-methylphenyl)-5-oxopyrrolidine-3-sulfonamide (PubChem CID 168717594) has the molecular formula C13H18N2O5S and a molecular weight of 314.36 g/mol. Its IUPAC name is 1-(4,5-dimethoxy-2-methylphenyl)-5-oxopyrrolidine-3-sulfonamide.
| Compound Name | 1-(4,5-dimethoxy-2-methylphenyl)-5-oxopyrrolidine-3-sulfonamide |
|---|---|
| PubChem CID | 168717594 |
| Molecular Formula | C13H18N2O5S |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-(4,5-dimethoxy-2-methylphenyl)-5-oxopyrrolidine-3-sulfonamide |
| SMILES | COc1cc(C)c(N2CC(S(N)(=O)=O)CC2=O)cc1OC |
| InChI | InChI=1S/C13H18N2O5S/c1-8-4-11(19-2)12(20-3)6-10(8)15-7-9(5-13(15)16)21(14,17)18/h4,6,9H,5,7H2,1-3H3,(H2,14,17,18) |
| InChIKey | FFUWDXXTLUMPIR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 98.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |