C10H7BrClFN2O5S — CID 168715261
1-(4-bromo-5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715261) has the molecular formula C10H7BrClFN2O5S and a molecular weight of 401.60 g/mol. Its IUPAC name is 1-(4-bromo-5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(4-bromo-5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715261 |
| Molecular Formula | C10H7BrClFN2O5S |
| Molecular Weight | 401.60 g/mol |
| Exact Mass | 399.89 |
| IUPAC Name | 1-(4-bromo-5-chloro-2-nitrophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1cc(Cl)c(Br)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H7BrClFN2O5S/c11-6-2-9(15(17)18)8(3-7(6)12)14-4-5(1-10(14)16)21(13,19)20/h2-3,5H,1,4H2 |
| InChIKey | QFDHNQDUVACVFT-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.60 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|