C10H7Cl3FNO3S — CID 168715174
5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidine-3-sulfonyl fluoride (PubChem CID 168715174) has the molecular formula C10H7Cl3FNO3S and a molecular weight of 346.59 g/mol. Its IUPAC name is 5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidine-3-sulfonyl fluoride.
| Compound Name | 5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715174 |
| Molecular Formula | C10H7Cl3FNO3S |
| Molecular Weight | 346.59 g/mol |
| Exact Mass | 344.92 |
| IUPAC Name | 5-oxo-1-(2,4,5-trichlorophenyl)pyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C10H7Cl3FNO3S/c11-6-2-8(13)9(3-7(6)12)15-4-5(1-10(15)16)19(14,17)18/h2-3,5H,1,4H2 |
| InChIKey | DACNCJSOXQVODS-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.59 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|