C10H10ClFN2O3S — CID 168714532
1-(6-chloro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714532) has the molecular formula C10H10ClFN2O3S and a molecular weight of 292.72 g/mol. Its IUPAC name is 1-(6-chloro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(6-chloro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714532 |
| Molecular Formula | C10H10ClFN2O3S |
| Molecular Weight | 292.72 g/mol |
| Exact Mass | 292.01 |
| IUPAC Name | 1-(6-chloro-4-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cc1cc(Cl)ncc1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C10H10ClFN2O3S/c1-6-2-9(11)13-4-8(6)14-5-7(3-10(14)15)18(12,16)17/h2,4,7H,3,5H2,1H3 |
| InChIKey | JKRWFJKDYHZLCG-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.72 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|