C9H7Cl2FN2O3S — CID 168715950
1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715950) has the molecular formula C9H7Cl2FN2O3S and a molecular weight of 313.14 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715950 |
| Molecular Formula | C9H7Cl2FN2O3S |
| Molecular Weight | 313.14 g/mol |
| Exact Mass | 311.95 |
| IUPAC Name | 1-(2,6-dichloro-4-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1cc(Cl)nc(Cl)c1 |
| InChI | InChI=1S/C9H7Cl2FN2O3S/c10-7-1-5(2-8(11)13-7)14-4-6(3-9(14)15)18(12,16)17/h1-2,6H,3-4H2 |
| InChIKey | DNQRLDBAGOMKCK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.14 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|