C9H9ClFN3O3S — CID 168715376
1-(3-amino-6-chloro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715376) has the molecular formula C9H9ClFN3O3S and a molecular weight of 293.71 g/mol. Its IUPAC name is 1-(3-amino-6-chloro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(3-amino-6-chloro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715376 |
| Molecular Formula | C9H9ClFN3O3S |
| Molecular Weight | 293.71 g/mol |
| Exact Mass | 293.00 |
| IUPAC Name | 1-(3-amino-6-chloro-2-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Nc1ccc(Cl)nc1N1CC(S(=O)(=O)F)CC1=O |
| InChI | InChI=1S/C9H9ClFN3O3S/c10-7-2-1-6(12)9(13-7)14-4-5(3-8(14)15)18(11,16)17/h1-2,5H,3-4,12H2 |
| InChIKey | QGPBVBNGUUEZGM-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 93.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.71 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|