C8H9FN4O4S — CID 168715839
1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715839) has the molecular formula C8H9FN4O4S and a molecular weight of 276.25 g/mol. Its IUPAC name is 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715839 |
| Molecular Formula | C8H9FN4O4S |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | 1-(5-amino-6-oxo-1H-pyrimidin-4-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Nc1c(N2CC(S(=O)(=O)F)CC2=O)nc[nH]c1=O |
| InChI | InChI=1S/C8H9FN4O4S/c9-18(16,17)4-1-5(14)13(2-4)7-6(10)8(15)12-3-11-7/h3-4H,1-2,10H2,(H,11,12,15) |
| InChIKey | WOBLLYDRGVJCCC-UHFFFAOYSA-N |
| XLogP | -1.24 |
| TPSA | 126.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | -1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |