C8H8FN3O4S — CID 168716295
5-oxo-1-(2-oxo-1H-pyrazin-3-yl)pyrrolidine-3-sulfonyl fluoride (PubChem CID 168716295) has the molecular formula C8H8FN3O4S and a molecular weight of 261.23 g/mol. Its IUPAC name is 5-oxo-1-(2-oxo-1H-pyrazin-3-yl)pyrrolidine-3-sulfonyl fluoride.
| Compound Name | 5-oxo-1-(2-oxo-1H-pyrazin-3-yl)pyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168716295 |
| Molecular Formula | C8H8FN3O4S |
| Molecular Weight | 261.23 g/mol |
| Exact Mass | 261.02 |
| IUPAC Name | 5-oxo-1-(2-oxo-1H-pyrazin-3-yl)pyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1ncc[nH]c1=O |
| InChI | InChI=1S/C8H8FN3O4S/c9-17(15,16)5-3-6(13)12(4-5)7-8(14)11-2-1-10-7/h1-2,5H,3-4H2,(H,11,14) |
| InChIKey | MNUZHKMZPAFJMH-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 100.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.23 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |