About 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride
5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride (PubChem CID 168716296) has the molecular formula C7H7FN4O3S
and a molecular weight of 246.22 g/mol. Its IUPAC name is 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride.
Analyze 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride (CID 168716296) is 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride is O=C1CC(S(=O)(=O)F)CN1c1nccnn1.
What is the InChIKey of 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride?
The InChIKey is CHGZWOLNELNODZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7FN4O3S/c8-16(14,15)5-3-6(13)12(4-5)7-9-1-2-10-11-7/h1-2,5H,3-4H2.
What are the key properties of 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride?
5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride has a molecular weight of 246.22 g/mol, XLogP of -0.72, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-oxo-1-(1,2,4-triazin-3-yl)pyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168716296), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).