C9H8FIN2O3S — CID 168715519
1-(6-iodo-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715519) has the molecular formula C9H8FIN2O3S and a molecular weight of 370.14 g/mol. Its IUPAC name is 1-(6-iodo-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(6-iodo-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715519 |
| Molecular Formula | C9H8FIN2O3S |
| Molecular Weight | 370.14 g/mol |
| Exact Mass | 369.93 |
| IUPAC Name | 1-(6-iodo-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1ccc(I)nc1 |
| InChI | InChI=1S/C9H8FIN2O3S/c10-17(15,16)7-3-9(14)13(5-7)6-1-2-8(11)12-4-6/h1-2,4,7H,3,5H2 |
| InChIKey | QPFGYGAEOJFPOF-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.14 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|