1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride

C10H8F3NO3S — CID 168715421

IUPAC1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride
SMILESO=C1CC(S(=O)(=O)F)CN1c1ccc(F)c(F)c1
InChIInChI=1S/C10H8F3NO3S/c11-8-2-1-6(3-9(8)12)14-5-7(4-10(14)15)18(13,16)17/h1-3,7H,4-5H2
InChIKeyOVSHDWRZPDPKNN-UHFFFAOYSA-N
MW279.24 g/mol
LogP1.37
Rot. Bonds2

About 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride

1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715421) has the molecular formula C10H8F3NO3S and a molecular weight of 279.24 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.

Molecular Properties

Compound Name1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride
PubChem CID168715421
Molecular FormulaC10H8F3NO3S
Molecular Weight279.24 g/mol
Exact Mass279.02
IUPAC Name1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride
SMILESO=C1CC(S(=O)(=O)F)CN1c1ccc(F)c(F)c1
InChIInChI=1S/C10H8F3NO3S/c11-8-2-1-6(3-9(8)12)14-5-7(4-10(14)15)18(13,16)17/h1-3,7H,4-5H2
InChIKeyOVSHDWRZPDPKNN-UHFFFAOYSA-N
XLogP1.37
TPSA54.45 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500279.24
LogP ≤ 51.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Analyze 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The IUPAC name of 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (CID 168715421) is 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
What is the SMILES notation for 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The canonical SMILES for 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride is O=C1CC(S(=O)(=O)F)CN1c1ccc(F)c(F)c1.
What is the InChIKey of 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
The InChIKey is OVSHDWRZPDPKNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8F3NO3S/c11-8-2-1-6(3-9(8)12)14-5-7(4-10(14)15)18(13,16)17/h1-3,7H,4-5H2.
What are the key properties of 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride?
1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride has a molecular weight of 279.24 g/mol, XLogP of 1.37, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride is sourced from PubChem (CID 168715421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).