C10H8F3NO3S — CID 168715421
1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715421) has the molecular formula C10H8F3NO3S and a molecular weight of 279.24 g/mol. Its IUPAC name is 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715421 |
| Molecular Formula | C10H8F3NO3S |
| Molecular Weight | 279.24 g/mol |
| Exact Mass | 279.02 |
| IUPAC Name | 1-(3,4-difluorophenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C10H8F3NO3S/c11-8-2-1-6(3-9(8)12)14-5-7(4-10(14)15)18(13,16)17/h1-3,7H,4-5H2 |
| InChIKey | OVSHDWRZPDPKNN-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.24 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |