C11H9F4NO3S — CID 168715991
5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-sulfonyl fluoride (PubChem CID 168715991) has the molecular formula C11H9F4NO3S and a molecular weight of 311.26 g/mol. Its IUPAC name is 5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-sulfonyl fluoride.
| Compound Name | 5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715991 |
| Molecular Formula | C11H9F4NO3S |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 311.02 |
| IUPAC Name | 5-oxo-1-[4-(trifluoromethyl)phenyl]pyrrolidine-3-sulfonyl fluoride |
| SMILES | O=C1CC(S(=O)(=O)F)CN1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H9F4NO3S/c12-11(13,14)7-1-3-8(4-2-7)16-6-9(5-10(16)17)20(15,18)19/h1-4,9H,5-6H2 |
| InChIKey | REIRGLLEBZANHF-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |