C14H18FNO3S — CID 168713526
1-(3-tert-butylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168713526) has the molecular formula C14H18FNO3S and a molecular weight of 299.37 g/mol. Its IUPAC name is 1-(3-tert-butylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(3-tert-butylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168713526 |
| Molecular Formula | C14H18FNO3S |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1-(3-tert-butylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CC(C)(C)c1cccc(N2CC(S(=O)(=O)F)CC2=O)c1 |
| InChI | InChI=1S/C14H18FNO3S/c1-14(2,3)10-5-4-6-11(7-10)16-9-12(8-13(16)17)20(15,18)19/h4-7,12H,8-9H2,1-3H3 |
| InChIKey | HJDMSYVXMGXXKV-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |