C11H12FNO3S2 — CID 168714211
1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714211) has the molecular formula C11H12FNO3S2 and a molecular weight of 289.35 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714211 |
| Molecular Formula | C11H12FNO3S2 |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | CSc1ccc(N2CC(S(=O)(=O)F)CC2=O)cc1 |
| InChI | InChI=1S/C11H12FNO3S2/c1-17-9-4-2-8(3-5-9)13-7-10(6-11(13)14)18(12,15)16/h2-5,10H,6-7H2,1H3 |
| InChIKey | ITQZMULATWUYAW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |