C9H11FN4O3S — CID 168714658
1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714658) has the molecular formula C9H11FN4O3S and a molecular weight of 274.28 g/mol. Its IUPAC name is 1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714658 |
| Molecular Formula | C9H11FN4O3S |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cc1cc(N)nc(N2CC(S(=O)(=O)F)CC2=O)n1 |
| InChI | InChI=1S/C9H11FN4O3S/c1-5-2-7(11)13-9(12-5)14-4-6(3-8(14)15)18(10,16)17/h2,6H,3-4H2,1H3,(H2,11,12,13) |
| InChIKey | NWNHEFUZHDADFF-UHFFFAOYSA-N |
| XLogP | -0.23 |
| TPSA | 106.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |