C10H15N5O3S — CID 168681741
[1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168681741) has the molecular formula C10H15N5O3S and a molecular weight of 285.33 g/mol. Its IUPAC name is [1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168681741 |
| Molecular Formula | C10H15N5O3S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | [1-(4-amino-6-methylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | Cc1cc(N)nc(N2CC(CS(N)(=O)=O)CC2=O)n1 |
| InChI | InChI=1S/C10H15N5O3S/c1-6-2-8(11)14-10(13-6)15-4-7(3-9(15)16)5-19(12,17)18/h2,7H,3-5H2,1H3,(H2,11,13,14)(H2,12,17,18) |
| InChIKey | RVBQIVWABOJGLJ-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 132.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |