C10H10Cl2N4O4S — CID 168683290
[1-(4,6-dichloro-5-formylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide (PubChem CID 168683290) has the molecular formula C10H10Cl2N4O4S and a molecular weight of 353.19 g/mol. Its IUPAC name is [1-(4,6-dichloro-5-formylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide.
| Compound Name | [1-(4,6-dichloro-5-formylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 168683290 |
| Molecular Formula | C10H10Cl2N4O4S |
| Molecular Weight | 353.19 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | [1-(4,6-dichloro-5-formylpyrimidin-2-yl)-5-oxopyrrolidin-3-yl]methanesulfonamide |
| SMILES | NS(=O)(=O)CC1CC(=O)N(c2nc(Cl)c(C=O)c(Cl)n2)C1 |
| InChI | InChI=1S/C10H10Cl2N4O4S/c11-8-6(3-17)9(12)15-10(14-8)16-2-5(1-7(16)18)4-21(13,19)20/h3,5H,1-2,4H2,(H2,13,19,20) |
| InChIKey | LNHIHOMLRSLYAJ-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.19 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|