C9H8BrCl2N3OS — CID 168671847
1-(5-bromo-4,6-dichloropyrimidin-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671847) has the molecular formula C9H8BrCl2N3OS and a molecular weight of 357.06 g/mol. Its IUPAC name is 1-(5-bromo-4,6-dichloropyrimidin-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(5-bromo-4,6-dichloropyrimidin-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671847 |
| Molecular Formula | C9H8BrCl2N3OS |
| Molecular Weight | 357.06 g/mol |
| Exact Mass | 354.89 |
| IUPAC Name | 1-(5-bromo-4,6-dichloropyrimidin-2-yl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1nc(Cl)c(Br)c(Cl)n1 |
| InChI | InChI=1S/C9H8BrCl2N3OS/c10-6-7(11)13-9(14-8(6)12)15-2-4(3-17)1-5(15)16/h4,17H,1-3H2 |
| InChIKey | FPLRLXDBGCOMNB-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.06 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|