C11H11Br2NOS — CID 168671218
1-(2,6-dibromophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168671218) has the molecular formula C11H11Br2NOS and a molecular weight of 365.09 g/mol. Its IUPAC name is 1-(2,6-dibromophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2,6-dibromophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168671218 |
| Molecular Formula | C11H11Br2NOS |
| Molecular Weight | 365.09 g/mol |
| Exact Mass | 362.89 |
| IUPAC Name | 1-(2,6-dibromophenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1c(Br)cccc1Br |
| InChI | InChI=1S/C11H11Br2NOS/c12-8-2-1-3-9(13)11(8)14-5-7(6-16)4-10(14)15/h1-3,7,16H,4-6H2 |
| InChIKey | LXGLGNCAPRFNMW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.09 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|