C12H13BrClNOS — CID 168670611
1-(2-bromo-4-chloro-6-methylphenyl)-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168670611) has the molecular formula C12H13BrClNOS and a molecular weight of 334.67 g/mol. Its IUPAC name is 1-(2-bromo-4-chloro-6-methylphenyl)-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-(2-bromo-4-chloro-6-methylphenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168670611 |
| Molecular Formula | C12H13BrClNOS |
| Molecular Weight | 334.67 g/mol |
| Exact Mass | 332.96 |
| IUPAC Name | 1-(2-bromo-4-chloro-6-methylphenyl)-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | Cc1cc(Cl)cc(Br)c1N1CC(CS)CC1=O |
| InChI | InChI=1S/C12H13BrClNOS/c1-7-2-9(14)4-10(13)12(7)15-5-8(6-17)3-11(15)16/h2,4,8,17H,3,5-6H2,1H3 |
| InChIKey | UAHUWWUOJAAOOO-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|