C10H9BrClFN2O3S — CID 168714445
1-(5-bromo-2-chloro-6-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714445) has the molecular formula C10H9BrClFN2O3S and a molecular weight of 371.62 g/mol. Its IUPAC name is 1-(5-bromo-2-chloro-6-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(5-bromo-2-chloro-6-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714445 |
| Molecular Formula | C10H9BrClFN2O3S |
| Molecular Weight | 371.62 g/mol |
| Exact Mass | 369.92 |
| IUPAC Name | 1-(5-bromo-2-chloro-6-methyl-3-pyridinyl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cc1nc(Cl)c(N2CC(S(=O)(=O)F)CC2=O)cc1Br |
| InChI | InChI=1S/C10H9BrClFN2O3S/c1-5-7(11)3-8(10(12)14-5)15-4-6(2-9(15)16)19(13,17)18/h3,6H,2,4H2,1H3 |
| InChIKey | YUWLJPUHLGBEPV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 67.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.62 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|