C8H11FN4O3S — CID 168714641
1-(4-amino-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168714641) has the molecular formula C8H11FN4O3S and a molecular weight of 262.27 g/mol. Its IUPAC name is 1-(4-amino-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-(4-amino-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168714641 |
| Molecular Formula | C8H11FN4O3S |
| Molecular Weight | 262.27 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 1-(4-amino-5-methyl-1H-pyrazol-3-yl)-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | Cc1[nH]nc(N2CC(S(=O)(=O)F)CC2=O)c1N |
| InChI | InChI=1S/C8H11FN4O3S/c1-4-7(10)8(12-11-4)13-3-5(2-6(13)14)17(9,15)16/h5H,2-3,10H2,1H3,(H,11,12) |
| InChIKey | KMEACNQIIGABCX-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 109.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |