C10H8FN5O3S — CID 168715124
1-[4-cyano-5-(cyanomethyl)-1H-pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride (PubChem CID 168715124) has the molecular formula C10H8FN5O3S and a molecular weight of 297.27 g/mol. Its IUPAC name is 1-[4-cyano-5-(cyanomethyl)-1H-pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride.
| Compound Name | 1-[4-cyano-5-(cyanomethyl)-1H-pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride |
|---|---|
| PubChem CID | 168715124 |
| Molecular Formula | C10H8FN5O3S |
| Molecular Weight | 297.27 g/mol |
| Exact Mass | 297.03 |
| IUPAC Name | 1-[4-cyano-5-(cyanomethyl)-1H-pyrazol-3-yl]-5-oxopyrrolidine-3-sulfonyl fluoride |
| SMILES | N#CCc1[nH]nc(N2CC(S(=O)(=O)F)CC2=O)c1C#N |
| InChI | InChI=1S/C10H8FN5O3S/c11-20(18,19)6-3-9(17)16(5-6)10-7(4-13)8(1-2-12)14-15-10/h6H,1,3,5H2,(H,14,15) |
| InChIKey | LHWQCCPOMRPGGQ-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 130.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.27 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |