C10H11N7O — CID 168656986
3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyrazole-4-carbonitrile (PubChem CID 168656986) has the molecular formula C10H11N7O and a molecular weight of 245.25 g/mol. Its IUPAC name is 3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyrazole-4-carbonitrile.
| Compound Name | 3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 168656986 |
| Molecular Formula | C10H11N7O |
| Molecular Weight | 245.25 g/mol |
| Exact Mass | 245.10 |
| IUPAC Name | 3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-5-methyl-1H-pyrazole-4-carbonitrile |
| SMILES | Cc1[nH]nc(N2CC(CN=[N+]=[N-])CC2=O)c1C#N |
| InChI | InChI=1S/C10H11N7O/c1-6-8(3-11)10(15-14-6)17-5-7(2-9(17)18)4-13-16-12/h7H,2,4-5H2,1H3,(H,14,15) |
| InChIKey | PLNTVYMCUJWZKP-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 121.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|