C8H9N7O3 — CID 168658529
3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-1,2,4-triazole-5-carboxylic acid (PubChem CID 168658529) has the molecular formula C8H9N7O3 and a molecular weight of 251.21 g/mol. Its IUPAC name is 3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-1,2,4-triazole-5-carboxylic acid.
| Compound Name | 3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-1,2,4-triazole-5-carboxylic acid |
|---|---|
| PubChem CID | 168658529 |
| Molecular Formula | C8H9N7O3 |
| Molecular Weight | 251.21 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 3-[4-(azidomethyl)-2-oxopyrrolidin-1-yl]-1H-1,2,4-triazole-5-carboxylic acid |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2n[nH]c(C(=O)O)n2)C1 |
| InChI | InChI=1S/C8H9N7O3/c9-14-10-2-4-1-5(16)15(3-4)8-11-6(7(17)18)12-13-8/h4H,1-3H2,(H,17,18)(H,11,12,13) |
| InChIKey | GOEOCGVZUPBQPT-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 147.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.21 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|