C14H14N6OS — CID 168658502
1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(azidomethyl)pyrrolidin-2-one (PubChem CID 168658502) has the molecular formula C14H14N6OS and a molecular weight of 314.37 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(azidomethyl)pyrrolidin-2-one.
| Compound Name | 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(azidomethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168658502 |
| Molecular Formula | C14H14N6OS |
| Molecular Weight | 314.37 g/mol |
| Exact Mass | 314.09 |
| IUPAC Name | 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(azidomethyl)pyrrolidin-2-one |
| SMILES | [N-]=[N+]=NCC1CC(=O)N(c2nc(-c3ccc(N)cc3)cs2)C1 |
| InChI | InChI=1S/C14H14N6OS/c15-11-3-1-10(2-4-11)12-8-22-14(18-12)20-7-9(5-13(20)21)6-17-19-16/h1-4,8-9H,5-7,15H2 |
| InChIKey | UOWOCSXCPPCDDV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 107.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|