C16H16N2O2S2 — CID 168668940
S-[[5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668940) has the molecular formula C16H16N2O2S2 and a molecular weight of 332.45 g/mol. Its IUPAC name is S-[[5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668940 |
| Molecular Formula | C16H16N2O2S2 |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.07 |
| IUPAC Name | S-[[5-oxo-1-(4-phenyl-1,3-thiazol-2-yl)pyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2nc(-c3ccccc3)cs2)C1 |
| InChI | InChI=1S/C16H16N2O2S2/c1-11(19)21-9-12-7-15(20)18(8-12)16-17-14(10-22-16)13-5-3-2-4-6-13/h2-6,10,12H,7-9H2,1H3 |
| InChIKey | PYYZRLMSICLGCS-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 50.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|