C16H17N3O2S2 — CID 168668930
S-[[1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate (PubChem CID 168668930) has the molecular formula C16H17N3O2S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is S-[[1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate.
| Compound Name | S-[[1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
|---|---|
| PubChem CID | 168668930 |
| Molecular Formula | C16H17N3O2S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.08 |
| IUPAC Name | S-[[1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-5-oxopyrrolidin-3-yl]methyl] ethanethioate |
| SMILES | CC(=O)SCC1CC(=O)N(c2ccc(-c3csc(N)n3)cc2)C1 |
| InChI | InChI=1S/C16H17N3O2S2/c1-10(20)22-8-11-6-15(21)19(7-11)13-4-2-12(3-5-13)14-9-23-16(17)18-14/h2-5,9,11H,6-8H2,1H3,(H2,17,18) |
| InChIKey | ADUYQEARYNRJDO-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|