C13H12ClN3OS — CID 168689905
1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-4-chloropyrrolidin-2-one (PubChem CID 168689905) has the molecular formula C13H12ClN3OS and a molecular weight of 293.78 g/mol. Its IUPAC name is 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-4-chloropyrrolidin-2-one.
| Compound Name | 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-4-chloropyrrolidin-2-one |
|---|---|
| PubChem CID | 168689905 |
| Molecular Formula | C13H12ClN3OS |
| Molecular Weight | 293.78 g/mol |
| Exact Mass | 293.04 |
| IUPAC Name | 1-[4-(2-amino-1,3-thiazol-4-yl)phenyl]-4-chloropyrrolidin-2-one |
| SMILES | Nc1nc(-c2ccc(N3CC(Cl)CC3=O)cc2)cs1 |
| InChI | InChI=1S/C13H12ClN3OS/c14-9-5-12(18)17(6-9)10-3-1-8(2-4-10)11-7-19-13(15)16-11/h1-4,7,9H,5-6H2,(H2,15,16) |
| InChIKey | PNORJCVTLNHRMU-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.78 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|