C16H16N2OS — CID 168685050
4-ethenyl-1-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one (PubChem CID 168685050) has the molecular formula C16H16N2OS and a molecular weight of 284.38 g/mol. Its IUPAC name is 4-ethenyl-1-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one.
| Compound Name | 4-ethenyl-1-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one |
|---|---|
| PubChem CID | 168685050 |
| Molecular Formula | C16H16N2OS |
| Molecular Weight | 284.38 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 4-ethenyl-1-[4-(2-methyl-1,3-thiazol-4-yl)phenyl]pyrrolidin-2-one |
| SMILES | C=CC1CC(=O)N(c2ccc(-c3csc(C)n3)cc2)C1 |
| InChI | InChI=1S/C16H16N2OS/c1-3-12-8-16(19)18(9-12)14-6-4-13(5-7-14)15-10-20-11(2)17-15/h3-7,10,12H,1,8-9H2,2H3 |
| InChIKey | FUTGIXHGCLVHAD-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.38 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|