C14H15N3OS2 — CID 168672258
1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 168672258) has the molecular formula C14H15N3OS2 and a molecular weight of 305.43 g/mol. Its IUPAC name is 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(sulfanylmethyl)pyrrolidin-2-one.
| Compound Name | 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(sulfanylmethyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168672258 |
| Molecular Formula | C14H15N3OS2 |
| Molecular Weight | 305.43 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | 1-[4-(4-aminophenyl)-1,3-thiazol-2-yl]-4-(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | Nc1ccc(-c2csc(N3CC(CS)CC3=O)n2)cc1 |
| InChI | InChI=1S/C14H15N3OS2/c15-11-3-1-10(2-4-11)12-8-20-14(16-12)17-6-9(7-19)5-13(17)18/h1-4,8-9,19H,5-7,15H2 |
| InChIKey | BNCYXHRFVZKHBI-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.43 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|