C12H12N2OS3 — CID 168672273
4-(sulfanylmethyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)pyrrolidin-2-one (PubChem CID 168672273) has the molecular formula C12H12N2OS3 and a molecular weight of 296.44 g/mol. Its IUPAC name is 4-(sulfanylmethyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)pyrrolidin-2-one.
| Compound Name | 4-(sulfanylmethyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 168672273 |
| Molecular Formula | C12H12N2OS3 |
| Molecular Weight | 296.44 g/mol |
| Exact Mass | 296.01 |
| IUPAC Name | 4-(sulfanylmethyl)-1-(4-thiophen-2-yl-1,3-thiazol-2-yl)pyrrolidin-2-one |
| SMILES | O=C1CC(CS)CN1c1nc(-c2cccs2)cs1 |
| InChI | InChI=1S/C12H12N2OS3/c15-11-4-8(6-16)5-14(11)12-13-9(7-18-12)10-2-1-3-17-10/h1-3,7-8,16H,4-6H2 |
| InChIKey | DMOXSFRJJOWZBE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 33.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.44 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|